C24H24F2N2O2 — CID 144778200
2-[2-[[3-[3-(aminomethyl)-2-fluorophenyl]-5-(2-fluoroethylamino)phenyl]methoxy]phenyl]acetaldehyde (PubChem CID 144778200) has the molecular formula C24H24F2N2O2 and a molecular weight of 410.46 g/mol. Its IUPAC name is 2-[2-[[3-[3-(aminomethyl)-2-fluorophenyl]-5-(2-fluoroethylamino)phenyl]methoxy]phenyl]acetaldehyde.
| Compound Name | 2-[2-[[3-[3-(aminomethyl)-2-fluorophenyl]-5-(2-fluoroethylamino)phenyl]methoxy]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 144778200 |
| Molecular Formula | C24H24F2N2O2 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[2-[[3-[3-(aminomethyl)-2-fluorophenyl]-5-(2-fluoroethylamino)phenyl]methoxy]phenyl]acetaldehyde |
| SMILES | NCc1cccc(-c2cc(COc3ccccc3CC=O)cc(NCCF)c2)c1F |
| InChI | InChI=1S/C24H24F2N2O2/c25-9-10-28-21-13-17(16-30-23-7-2-1-4-18(23)8-11-29)12-20(14-21)22-6-3-5-19(15-27)24(22)26/h1-7,11-14,28H,8-10,15-16,27H2 |
| InChIKey | PYOXXCRZKBVCMH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|