C32H40F2N2O4 — CID 144778107
tert-butyl 2-[2-[[3-[3-(1-amino-2-fluoroethyl)-2-fluorophenyl]-5-(5-hydroxypentylamino)phenyl]methoxy]phenyl]acetate (PubChem CID 144778107) has the molecular formula C32H40F2N2O4 and a molecular weight of 554.68 g/mol. Its IUPAC name is tert-butyl 2-[2-[[3-[3-(1-amino-2-fluoroethyl)-2-fluorophenyl]-5-(5-hydroxypentylamino)phenyl]methoxy]phenyl]acetate.
| Compound Name | tert-butyl 2-[2-[[3-[3-(1-amino-2-fluoroethyl)-2-fluorophenyl]-5-(5-hydroxypentylamino)phenyl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 144778107 |
| Molecular Formula | C32H40F2N2O4 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | tert-butyl 2-[2-[[3-[3-(1-amino-2-fluoroethyl)-2-fluorophenyl]-5-(5-hydroxypentylamino)phenyl]methoxy]phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1ccccc1OCc1cc(NCCCCCO)cc(-c2cccc(C(N)CF)c2F)c1 |
| InChI | InChI=1S/C32H40F2N2O4/c1-32(2,3)40-30(38)19-23-10-5-6-13-29(23)39-21-22-16-24(18-25(17-22)36-14-7-4-8-15-37)26-11-9-12-27(31(26)34)28(35)20-33/h5-6,9-13,16-18,28,36-37H,4,7-8,14-15,19-21,35H2,1-3H3 |
| InChIKey | MGTVBGCEYANWIB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|