C27H27FN2O5 — CID 166657991
3-methoxypropyl 2-[2-[[4-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-1-benzofuran-6-yl]methoxy]phenyl]acetate (PubChem CID 166657991) has the molecular formula C27H27FN2O5 and a molecular weight of 478.52 g/mol. Its IUPAC name is 3-methoxypropyl 2-[2-[[4-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-1-benzofuran-6-yl]methoxy]phenyl]acetate.
| Compound Name | 3-methoxypropyl 2-[2-[[4-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-1-benzofuran-6-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 166657991 |
| Molecular Formula | C27H27FN2O5 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 3-methoxypropyl 2-[2-[[4-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-1-benzofuran-6-yl]methoxy]phenyl]acetate |
| SMILES | COCCCOC(=O)Cc1ccccc1OCc1cc(-c2ccnc(CN)c2F)c2ccoc2c1 |
| InChI | InChI=1S/C27H27FN2O5/c1-32-10-4-11-34-26(31)15-19-5-2-3-6-24(19)35-17-18-13-22(20-8-12-33-25(20)14-18)21-7-9-30-23(16-29)27(21)28/h2-3,5-9,12-14H,4,10-11,15-17,29H2,1H3 |
| InChIKey | LAMOVBLYVNEYHF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|