C21H24O4 — CID 91324608
ethane;ethyl 2-(7-phenylmethoxy-1-benzofuran-5-yl)acetate (PubChem CID 91324608) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is ethane;ethyl 2-(7-phenylmethoxy-1-benzofuran-5-yl)acetate.
| Compound Name | ethane;ethyl 2-(7-phenylmethoxy-1-benzofuran-5-yl)acetate |
|---|---|
| PubChem CID | 91324608 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | ethane;ethyl 2-(7-phenylmethoxy-1-benzofuran-5-yl)acetate |
| SMILES | CC.CCOC(=O)Cc1cc(OCc2ccccc2)c2occc2c1 |
| InChI | InChI=1S/C19H18O4.C2H6/c1-2-21-18(20)12-15-10-16-8-9-22-19(16)17(11-15)23-13-14-6-4-3-5-7-14;1-2/h3-11H,2,12-13H2,1H3;1-2H3 |
| InChIKey | BRPOMOHJXIKCKU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |