About 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate
1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate (PubChem CID 88628609) has the molecular formula C21H21NO3S
and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate.
Molecular Properties
| Compound Name | 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate |
| PubChem CID | 88628609 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate |
| SMILES | Cc1ccc(C(=S)c2cc(CC(=O)OC(C)CN)cc3ccoc23)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-13-3-5-16(6-4-13)21(26)18-10-15(9-17-7-8-24-20(17)18)11-19(23)25-14(2)12-22/h3-10,14H,11-12,22H2,1-2H3 |
| InChIKey | DMEZSTHRUSCLBZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate?
The IUPAC name of 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate (CID 88628609) is 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate.
What is the SMILES notation for 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate?
The canonical SMILES for 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate is Cc1ccc(C(=S)c2cc(CC(=O)OC(C)CN)cc3ccoc23)cc1.
What is the InChIKey of 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate?
The InChIKey is DMEZSTHRUSCLBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO3S/c1-13-3-5-16(6-4-13)21(26)18-10-15(9-17-7-8-24-20(17)18)11-19(23)25-14(2)12-22/h3-10,14H,11-12,22H2,1-2H3.
What are the key properties of 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate?
1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate has a molecular weight of 367.47 g/mol, XLogP of 3.94, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-yl 2-[7-(4-methylbenzenecarbothioyl)-1-benzofuran-5-yl]acetate is sourced from PubChem (CID 88628609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).