C18H17ClO3 — CID 4024551
[1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate (PubChem CID 4024551) has the molecular formula C18H17ClO3 and a molecular weight of 316.78 g/mol. Its IUPAC name is [1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate.
| Compound Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 4024551 |
| Molecular Formula | C18H17ClO3 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate |
| SMILES | Cc1ccc(C(=O)C(C)OC(=O)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H17ClO3/c1-12-3-7-15(8-4-12)18(21)13(2)22-17(20)11-14-5-9-16(19)10-6-14/h3-10,13H,11H2,1-2H3 |
| InChIKey | ZZZUADNCXIKDGE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |