C11H12ClNO3 — CID 7750311
[(2S)-1-amino-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate (PubChem CID 7750311) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 7750311 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate |
| SMILES | C[C@H](OC(=O)Cc1ccc(Cl)cc1)C(N)=O |
| InChI | InChI=1S/C11H12ClNO3/c1-7(11(13)15)16-10(14)6-8-2-4-9(12)5-3-8/h2-5,7H,6H2,1H3,(H2,13,15)/t7-/m0/s1 |
| InChIKey | QOHAVKSGEYYTLK-ZETCQYMHSA-N |
| XLogP | 1.30 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |