C11H12FNO3 — CID 8590359
[(2R)-1-amino-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate (PubChem CID 8590359) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 8590359 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1cccc(F)c1)C(N)=O |
| InChI | InChI=1S/C11H12FNO3/c1-7(11(13)15)16-10(14)6-8-3-2-4-9(12)5-8/h2-5,7H,6H2,1H3,(H2,13,15)/t7-/m1/s1 |
| InChIKey | MLMQWKXXLPDLIN-SSDOTTSWSA-N |
| XLogP | 0.79 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |