C11H13FN2O5S — CID 7961629
[(2S)-1-amino-1-oxopropan-2-yl] 2-[(3-fluorophenyl)sulfonylamino]acetate (PubChem CID 7961629) has the molecular formula C11H13FN2O5S and a molecular weight of 304.30 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-[(3-fluorophenyl)sulfonylamino]acetate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-[(3-fluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7961629 |
| Molecular Formula | C11H13FN2O5S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-[(3-fluorophenyl)sulfonylamino]acetate |
| SMILES | C[C@H](OC(=O)CNS(=O)(=O)c1cccc(F)c1)C(N)=O |
| InChI | InChI=1S/C11H13FN2O5S/c1-7(11(13)16)19-10(15)6-14-20(17,18)9-4-2-3-8(12)5-9/h2-5,7,14H,6H2,1H3,(H2,13,16)/t7-/m0/s1 |
| InChIKey | CIZBZFJIPMGELV-ZETCQYMHSA-N |
| XLogP | -0.48 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |