C17H16F2N2O5S — CID 7961636
[(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-[(3-fluorophenyl)sulfonylamino]acetate (PubChem CID 7961636) has the molecular formula C17H16F2N2O5S and a molecular weight of 398.39 g/mol. Its IUPAC name is [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-[(3-fluorophenyl)sulfonylamino]acetate.
| Compound Name | [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-[(3-fluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7961636 |
| Molecular Formula | C17H16F2N2O5S |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-[(3-fluorophenyl)sulfonylamino]acetate |
| SMILES | C[C@H](OC(=O)CNS(=O)(=O)c1cccc(F)c1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16F2N2O5S/c1-11(17(23)21-14-7-5-12(18)6-8-14)26-16(22)10-20-27(24,25)15-4-2-3-13(19)9-15/h2-9,11,20H,10H2,1H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | SAMVERMZFUMIQT-NSHDSACASA-N |
| XLogP | 1.81 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |