C11H11FN2O4S — CID 7961631
[(1S)-1-cyanoethyl] 2-[(3-fluorophenyl)sulfonylamino]acetate (PubChem CID 7961631) has the molecular formula C11H11FN2O4S and a molecular weight of 286.28 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 2-[(3-fluorophenyl)sulfonylamino]acetate.
| Compound Name | [(1S)-1-cyanoethyl] 2-[(3-fluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7961631 |
| Molecular Formula | C11H11FN2O4S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | [(1S)-1-cyanoethyl] 2-[(3-fluorophenyl)sulfonylamino]acetate |
| SMILES | C[C@@H](C#N)OC(=O)CNS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H11FN2O4S/c1-8(6-13)18-11(15)7-14-19(16,17)10-4-2-3-9(12)5-10/h2-5,8,14H,7H2,1H3/t8-/m0/s1 |
| InChIKey | KNRSCTMLNLDFKK-QMMMGPOBSA-N |
| XLogP | 0.56 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |