C20H22FNO5S — CID 7623956
[(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate (PubChem CID 7623956) has the molecular formula C20H22FNO5S and a molecular weight of 407.46 g/mol. Its IUPAC name is [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate.
| Compound Name | [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 7623956 |
| Molecular Formula | C20H22FNO5S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate |
| SMILES | CCc1ccc(NC(=O)[C@@H](C)OC(=O)CCS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H22FNO5S/c1-3-15-4-8-17(9-5-15)22-20(24)14(2)27-19(23)12-13-28(25,26)18-10-6-16(21)7-11-18/h4-11,14H,3,12-13H2,1-2H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | YNYWNEKNMBFHTA-CQSZACIVSA-N |
| XLogP | 3.12 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |