C10H14FN3O3S — CID 55102286
3-[(3-fluorophenyl)sulfonylamino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 55102286) has the molecular formula C10H14FN3O3S and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)sulfonylamino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[(3-fluorophenyl)sulfonylamino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 55102286 |
| Molecular Formula | C10H14FN3O3S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-[(3-fluorophenyl)sulfonylamino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CC(CNS(=O)(=O)c1cccc(F)c1)/C(N)=N/O |
| InChI | InChI=1S/C10H14FN3O3S/c1-7(10(12)14-15)6-13-18(16,17)9-4-2-3-8(11)5-9/h2-5,7,13,15H,6H2,1H3,(H2,12,14) |
| InChIKey | CNOFMFQWKOELTB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|