C21H26FNO3 — CID 8590367
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate (PubChem CID 8590367) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 8590367 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate |
| SMILES | C[C@H](OC(=O)Cc1cccc(F)c1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26FNO3/c1-13(26-19(24)9-14-3-2-4-18(22)8-14)20(25)23-21-10-15-5-16(11-21)7-17(6-15)12-21/h2-4,8,13,15-17H,5-7,9-12H2,1H3,(H,23,25)/t13-,15?,16?,17?,21?/m0/s1 |
| InChIKey | LPMOIVIWBVBWQX-FCLDQCEHSA-N |
| XLogP | 3.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |