C23H27N3O4 — CID 7789748
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 7789748) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 7789748 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1n[nH]c(=O)c2ccccc12)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H27N3O4/c1-13(21(28)24-23-10-14-6-15(11-23)8-16(7-14)12-23)30-20(27)9-19-17-4-2-3-5-18(17)22(29)26-25-19/h2-5,13-16H,6-12H2,1H3,(H,24,28)(H,26,29)/t13-,14?,15?,16?,23?/m1/s1 |
| InChIKey | QXCNLHKWXGPMSO-TWLOVUBOSA-N |
| XLogP | 2.48 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |