C14H20ClNO2 — CID 82532660
1-(propylamino)propan-2-yl 2-(4-chlorophenyl)acetate (PubChem CID 82532660) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 1-(propylamino)propan-2-yl 2-(4-chlorophenyl)acetate.
| Compound Name | 1-(propylamino)propan-2-yl 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 82532660 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(propylamino)propan-2-yl 2-(4-chlorophenyl)acetate |
| SMILES | CCCNCC(C)OC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClNO2/c1-3-8-16-10-11(2)18-14(17)9-12-4-6-13(15)7-5-12/h4-7,11,16H,3,8-10H2,1-2H3 |
| InChIKey | LMBQAEIOBNBBRH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|