C19H30N2O4 — CID 158999553
1-[5-(propylamino)pentylcarbamoyloxy]ethyl 2-phenylacetate (PubChem CID 158999553) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-[5-(propylamino)pentylcarbamoyloxy]ethyl 2-phenylacetate.
| Compound Name | 1-[5-(propylamino)pentylcarbamoyloxy]ethyl 2-phenylacetate |
|---|---|
| PubChem CID | 158999553 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 1-[5-(propylamino)pentylcarbamoyloxy]ethyl 2-phenylacetate |
| SMILES | CCCNCCCCCNC(=O)OC(C)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H30N2O4/c1-3-12-20-13-8-5-9-14-21-19(23)25-16(2)24-18(22)15-17-10-6-4-7-11-17/h4,6-7,10-11,16,20H,3,5,8-9,12-15H2,1-2H3,(H,21,23) |
| InChIKey | ZIICZNBBWOBMBO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|