C24H32N2O6 — CID 141260838
[methoxy(phenyl)methyl] N-[6-[[methoxy(phenyl)methoxy]carbonylamino]hexyl]carbamate (PubChem CID 141260838) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is [methoxy(phenyl)methyl] N-[6-[[methoxy(phenyl)methoxy]carbonylamino]hexyl]carbamate.
| Compound Name | [methoxy(phenyl)methyl] N-[6-[[methoxy(phenyl)methoxy]carbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 141260838 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [methoxy(phenyl)methyl] N-[6-[[methoxy(phenyl)methoxy]carbonylamino]hexyl]carbamate |
| SMILES | COC(OC(=O)NCCCCCCNC(=O)OC(OC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O6/c1-29-21(19-13-7-5-8-14-19)31-23(27)25-17-11-3-4-12-18-26-24(28)32-22(30-2)20-15-9-6-10-16-20/h5-10,13-16,21-22H,3-4,11-12,17-18H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | CPTVKBDNHGWVEE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|