About methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid
methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid (PubChem CID 158840357) has the molecular formula C17H29NO5S
and a molecular weight of 359.49 g/mol. Its IUPAC name is methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid.
Molecular Properties
| Compound Name | methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid |
| PubChem CID | 158840357 |
| Molecular Formula | C17H29NO5S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid |
| SMILES | C.CCCCCC(OC(=O)NCCCS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H25NO5S.CH4/c1-2-3-5-11-15(14-9-6-4-7-10-14)22-16(18)17-12-8-13-23(19,20)21;/h4,6-7,9-10,15H,2-3,5,8,11-13H2,1H3,(H,17,18)(H,19,20,21);1H4 |
| InChIKey | IYDUTFZKTBJBAC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid?
The IUPAC name of methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid (CID 158840357) is methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid.
What is the SMILES notation for methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid?
The canonical SMILES for methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid is C.CCCCCC(OC(=O)NCCCS(=O)(=O)O)c1ccccc1.
What is the InChIKey of methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid?
The InChIKey is IYDUTFZKTBJBAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO5S.CH4/c1-2-3-5-11-15(14-9-6-4-7-10-14)22-16(18)17-12-8-13-23(19,20)21;/h4,6-7,9-10,15H,2-3,5,8,11-13H2,1H3,(H,17,18)(H,19,20,21);1H4.
What are the key properties of methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid?
methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid has a molecular weight of 359.49 g/mol, XLogP of 3.95, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-(1-phenylhexoxycarbonylamino)propane-1-sulfonic acid is sourced from PubChem (CID 158840357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).