C19H18ClNO4 — CID 7750150
[(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate (PubChem CID 7750150) has the molecular formula C19H18ClNO4 and a molecular weight of 359.81 g/mol. Its IUPAC name is [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate.
| Compound Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 7750150 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)OC(=O)Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H18ClNO4/c1-12(22)15-4-3-5-17(11-15)21-19(24)13(2)25-18(23)10-14-6-8-16(20)9-7-14/h3-9,11,13H,10H2,1-2H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | NAFWHOKSDYYBAO-CYBMUJFWSA-N |
| XLogP | 3.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |