C23H21NO4 — CID 7828500
[(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-naphthalen-2-ylacetate (PubChem CID 7828500) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-naphthalen-2-ylacetate.
| Compound Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-naphthalen-2-ylacetate |
|---|---|
| PubChem CID | 7828500 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-naphthalen-2-ylacetate |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)OC(=O)Cc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C23H21NO4/c1-15(25)19-8-5-9-21(14-19)24-23(27)16(2)28-22(26)13-17-10-11-18-6-3-4-7-20(18)12-17/h3-12,14,16H,13H2,1-2H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | ZADAZMDIVKYPIP-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |