C23H25N2O2+ — CID 9261721
[(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl]-methyl-(naphthalen-2-ylmethyl)azanium (PubChem CID 9261721) has the molecular formula C23H25N2O2+ and a molecular weight of 361.47 g/mol. Its IUPAC name is [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl]-methyl-(naphthalen-2-ylmethyl)azanium.
| Compound Name | [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl]-methyl-(naphthalen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 9261721 |
| Molecular Formula | C23H25N2O2+ |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl]-methyl-(naphthalen-2-ylmethyl)azanium |
| SMILES | CC(=O)c1cccc(NC(=O)[C@H](C)[NH+](C)Cc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-16(23(27)24-22-10-6-9-20(14-22)17(2)26)25(3)15-18-11-12-19-7-4-5-8-21(19)13-18/h4-14,16H,15H2,1-3H3,(H,24,27)/p+1/t16-/m0/s1 |
| InChIKey | MUADZZGJOGKSJQ-INIZCTEOSA-O |
| XLogP | 3.08 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |