C19H22ClN2O2+ — CID 9251362
[(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl]-[(3-chlorophenyl)methyl]-methylazanium (PubChem CID 9251362) has the molecular formula C19H22ClN2O2+ and a molecular weight of 345.85 g/mol. Its IUPAC name is [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl]-[(3-chlorophenyl)methyl]-methylazanium.
| Compound Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl]-[(3-chlorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9251362 |
| Molecular Formula | C19H22ClN2O2+ |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl]-[(3-chlorophenyl)methyl]-methylazanium |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)[NH+](C)Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C19H21ClN2O2/c1-13(22(3)12-15-6-4-8-17(20)10-15)19(24)21-18-9-5-7-16(11-18)14(2)23/h4-11,13H,12H2,1-3H3,(H,21,24)/p+1/t13-/m1/s1 |
| InChIKey | WNTJXJSWPSYYTJ-CYBMUJFWSA-O |
| XLogP | 2.58 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |