C13H19ClN3O2+ — CID 9251049
(3-chlorophenyl)methyl-methyl-[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium (PubChem CID 9251049) has the molecular formula C13H19ClN3O2+ and a molecular weight of 284.77 g/mol. Its IUPAC name is (3-chlorophenyl)methyl-methyl-[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | (3-chlorophenyl)methyl-methyl-[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9251049 |
| Molecular Formula | C13H19ClN3O2+ |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (3-chlorophenyl)methyl-methyl-[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium |
| SMILES | CNC(=O)NC(=O)[C@@H](C)[NH+](C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-9(12(18)16-13(19)15-2)17(3)8-10-5-4-6-11(14)7-10/h4-7,9H,8H2,1-3H3,(H2,15,16,18,19)/p+1/t9-/m1/s1 |
| InChIKey | NBBBDZWBIPPJNS-SECBINFHSA-O |
| XLogP | 0.20 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |