C13H19BrN3O2+ — CID 9039859
(4-bromophenyl)methyl-methyl-[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium (PubChem CID 9039859) has the molecular formula C13H19BrN3O2+ and a molecular weight of 329.22 g/mol. Its IUPAC name is (4-bromophenyl)methyl-methyl-[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | (4-bromophenyl)methyl-methyl-[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9039859 |
| Molecular Formula | C13H19BrN3O2+ |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (4-bromophenyl)methyl-methyl-[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium |
| SMILES | CNC(=O)NC(=O)[C@H](C)[NH+](C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H18BrN3O2/c1-9(12(18)16-13(19)15-2)17(3)8-10-4-6-11(14)7-5-10/h4-7,9H,8H2,1-3H3,(H2,15,16,18,19)/p+1/t9-/m0/s1 |
| InChIKey | FRLRGRGDHUKTJK-VIFPVBQESA-O |
| XLogP | 0.31 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |