C23H20O3 — CID 2926303
[2-(4-methylphenyl)-2-oxo-1-phenylethyl] 2-phenylacetate (PubChem CID 2926303) has the molecular formula C23H20O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxo-1-phenylethyl] 2-phenylacetate.
| Compound Name | [2-(4-methylphenyl)-2-oxo-1-phenylethyl] 2-phenylacetate |
|---|---|
| PubChem CID | 2926303 |
| Molecular Formula | C23H20O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxo-1-phenylethyl] 2-phenylacetate |
| SMILES | Cc1ccc(C(=O)C(OC(=O)Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20O3/c1-17-12-14-19(15-13-17)22(25)23(20-10-6-3-7-11-20)26-21(24)16-18-8-4-2-5-9-18/h2-15,23H,16H2,1H3 |
| InChIKey | ZCYZNMAAPVTGGB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |