C21H17BrO5 — CID 139560672
ethyl 2-[4-[(7-bromo-1-benzofuran-5-yl)methoxy]-1-benzofuran-5-yl]acetate (PubChem CID 139560672) has the molecular formula C21H17BrO5 and a molecular weight of 429.27 g/mol. Its IUPAC name is ethyl 2-[4-[(7-bromo-1-benzofuran-5-yl)methoxy]-1-benzofuran-5-yl]acetate.
| Compound Name | ethyl 2-[4-[(7-bromo-1-benzofuran-5-yl)methoxy]-1-benzofuran-5-yl]acetate |
|---|---|
| PubChem CID | 139560672 |
| Molecular Formula | C21H17BrO5 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | ethyl 2-[4-[(7-bromo-1-benzofuran-5-yl)methoxy]-1-benzofuran-5-yl]acetate |
| SMILES | CCOC(=O)Cc1ccc2occc2c1OCc1cc(Br)c2occc2c1 |
| InChI | InChI=1S/C21H17BrO5/c1-2-24-19(23)11-14-3-4-18-16(6-8-25-18)20(14)27-12-13-9-15-5-7-26-21(15)17(22)10-13/h3-10H,2,11-12H2,1H3 |
| InChIKey | HRILXXOIYUXMGA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |