C26H33BrO4 — CID 139561372
ethyl 2-[2-[(7-bromo-1-benzofuran-5-yl)methoxy]-3-methylphenyl]acetate;hexane (PubChem CID 139561372) has the molecular formula C26H33BrO4 and a molecular weight of 489.45 g/mol. Its IUPAC name is ethyl 2-[2-[(7-bromo-1-benzofuran-5-yl)methoxy]-3-methylphenyl]acetate;hexane.
| Compound Name | ethyl 2-[2-[(7-bromo-1-benzofuran-5-yl)methoxy]-3-methylphenyl]acetate;hexane |
|---|---|
| PubChem CID | 139561372 |
| Molecular Formula | C26H33BrO4 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | ethyl 2-[2-[(7-bromo-1-benzofuran-5-yl)methoxy]-3-methylphenyl]acetate;hexane |
| SMILES | CCCCCC.CCOC(=O)Cc1cccc(C)c1OCc1cc(Br)c2occc2c1 |
| InChI | InChI=1S/C20H19BrO4.C6H14/c1-3-23-18(22)11-15-6-4-5-13(2)19(15)25-12-14-9-16-7-8-24-20(16)17(21)10-14;1-3-5-6-4-2/h4-10H,3,11-12H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | SIYDJLSZJQIMIE-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|