C20H16BrF3O4 — CID 139561139
ethyl 2-[2-[[7-bromo-3-(trifluoromethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 139561139) has the molecular formula C20H16BrF3O4 and a molecular weight of 457.24 g/mol. Its IUPAC name is ethyl 2-[2-[[7-bromo-3-(trifluoromethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[7-bromo-3-(trifluoromethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 139561139 |
| Molecular Formula | C20H16BrF3O4 |
| Molecular Weight | 457.24 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | ethyl 2-[2-[[7-bromo-3-(trifluoromethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cc(Br)c2occ(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C20H16BrF3O4/c1-2-26-18(25)9-13-5-3-4-6-17(13)27-10-12-7-14-15(20(22,23)24)11-28-19(14)16(21)8-12/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | SWTHXFPSNOCADR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.24 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |