C17H17Cl3N4O2 — CID 178059044
ethyl (E)-3-amino-3-(3-chlorophenyl)-2-(N,2-diamino-4,5-dichloroanilino)prop-2-enoate (PubChem CID 178059044) has the molecular formula C17H17Cl3N4O2 and a molecular weight of 415.71 g/mol. Its IUPAC name is ethyl (E)-3-amino-3-(3-chlorophenyl)-2-(N,2-diamino-4,5-dichloroanilino)prop-2-enoate.
| Compound Name | ethyl (E)-3-amino-3-(3-chlorophenyl)-2-(N,2-diamino-4,5-dichloroanilino)prop-2-enoate |
|---|---|
| PubChem CID | 178059044 |
| Molecular Formula | C17H17Cl3N4O2 |
| Molecular Weight | 415.71 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | ethyl (E)-3-amino-3-(3-chlorophenyl)-2-(N,2-diamino-4,5-dichloroanilino)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C(\N)c1cccc(Cl)c1)N(N)c1cc(Cl)c(Cl)cc1N |
| InChI | InChI=1S/C17H17Cl3N4O2/c1-2-26-17(25)16(15(22)9-4-3-5-10(18)6-9)24(23)14-8-12(20)11(19)7-13(14)21/h3-8H,2,21-23H2,1H3/b16-15+ |
| InChIKey | XXARKKBTQSGHQN-FOCLMDBBSA-N |
| XLogP | 3.80 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.71 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|