C14H17Cl2N3O2 — CID 142545475
ethyl (Z)-3-amino-2-[amino(cyclopropyl)amino]-3-(2,6-dichlorophenyl)prop-2-enoate (PubChem CID 142545475) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is ethyl (Z)-3-amino-2-[amino(cyclopropyl)amino]-3-(2,6-dichlorophenyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-amino-2-[amino(cyclopropyl)amino]-3-(2,6-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 142545475 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | ethyl (Z)-3-amino-2-[amino(cyclopropyl)amino]-3-(2,6-dichlorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C(/N)c1c(Cl)cccc1Cl)N(N)C1CC1 |
| InChI | InChI=1S/C14H17Cl2N3O2/c1-2-21-14(20)13(19(18)8-6-7-8)12(17)11-9(15)4-3-5-10(11)16/h3-5,8H,2,6-7,17-18H2,1H3/b13-12- |
| InChIKey | WOPHEZIXGQPUCL-SEYXRHQNSA-N |
| XLogP | 2.52 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|