C15H15Cl2NO3 — CID 154032861
ethyl 3-cyclopropyl-2-(2,6-dichlorobenzenecarboximidoyl)-3-hydroxyprop-2-enoate (PubChem CID 154032861) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.19 g/mol. Its IUPAC name is ethyl 3-cyclopropyl-2-(2,6-dichlorobenzenecarboximidoyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 3-cyclopropyl-2-(2,6-dichlorobenzenecarboximidoyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 154032861 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | ethyl 3-cyclopropyl-2-(2,6-dichlorobenzenecarboximidoyl)-3-hydroxyprop-2-enoate |
| SMILES | [H]/N=C(\C(C(=O)OCC)=C(O)C1CC1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H15Cl2NO3/c1-2-21-15(20)12(14(19)8-6-7-8)13(18)11-9(16)4-3-5-10(11)17/h3-5,8,18-19H,2,6-7H2,1H3/b14-12?,18-13- |
| InChIKey | JLBHWCFIBKORDY-NIMOUNLVSA-N |
| XLogP | 4.15 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|