C17H17Cl2NO4S — CID 135443794
ethyl (E)-3-(cyclopropanecarbonyl)-4-(3,4-dichloro-2-methylsulfanylphenyl)-4-hydroxy-2-iminobut-3-enoate (PubChem CID 135443794) has the molecular formula C17H17Cl2NO4S and a molecular weight of 402.30 g/mol. Its IUPAC name is ethyl (E)-3-(cyclopropanecarbonyl)-4-(3,4-dichloro-2-methylsulfanylphenyl)-4-hydroxy-2-iminobut-3-enoate.
| Compound Name | ethyl (E)-3-(cyclopropanecarbonyl)-4-(3,4-dichloro-2-methylsulfanylphenyl)-4-hydroxy-2-iminobut-3-enoate |
|---|---|
| PubChem CID | 135443794 |
| Molecular Formula | C17H17Cl2NO4S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | ethyl (E)-3-(cyclopropanecarbonyl)-4-(3,4-dichloro-2-methylsulfanylphenyl)-4-hydroxy-2-iminobut-3-enoate |
| SMILES | [H]/N=C(C(=O)OCC)/C(C(=O)C1CC1)=C(\O)c1ccc(Cl)c(Cl)c1SC |
| InChI | InChI=1S/C17H17Cl2NO4S/c1-3-24-17(23)13(20)11(14(21)8-4-5-8)15(22)9-6-7-10(18)12(19)16(9)25-2/h6-8,20,22H,3-5H2,1-2H3/b15-11+,20-13- |
| InChIKey | HPWPALBDTASNON-RYZFGFNCSA-N |
| XLogP | 4.55 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|