C19H25Cl2NO — CID 3555098
2,6-dichloro-N,N-dicyclohexylbenzamide (PubChem CID 3555098) has the molecular formula C19H25Cl2NO and a molecular weight of 354.32 g/mol. Its IUPAC name is 2,6-dichloro-N,N-dicyclohexylbenzamide.
| Compound Name | 2,6-dichloro-N,N-dicyclohexylbenzamide |
|---|---|
| PubChem CID | 3555098 |
| Molecular Formula | C19H25Cl2NO |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2,6-dichloro-N,N-dicyclohexylbenzamide |
| SMILES | O=C(c1c(Cl)cccc1Cl)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H25Cl2NO/c20-16-12-7-13-17(21)18(16)19(23)22(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h7,12-15H,1-6,8-11H2 |
| InChIKey | XUUBGLCAKOEYEP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |