C14H16BrCl2NO — CID 80658796
N-(2-bromoethyl)-2,6-dichloro-N-cyclopentylbenzamide (PubChem CID 80658796) has the molecular formula C14H16BrCl2NO and a molecular weight of 365.10 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,6-dichloro-N-cyclopentylbenzamide.
| Compound Name | N-(2-bromoethyl)-2,6-dichloro-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 80658796 |
| Molecular Formula | C14H16BrCl2NO |
| Molecular Weight | 365.10 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | N-(2-bromoethyl)-2,6-dichloro-N-cyclopentylbenzamide |
| SMILES | O=C(c1c(Cl)cccc1Cl)N(CCBr)C1CCCC1 |
| InChI | InChI=1S/C14H16BrCl2NO/c15-8-9-18(10-4-1-2-5-10)14(19)13-11(16)6-3-7-12(13)17/h3,6-7,10H,1-2,4-5,8-9H2 |
| InChIKey | QAJYMJKICAXCJR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.10 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|