C15H18BrCl2NO — CID 80658625
N-(2-bromoethyl)-3,5-dichloro-N-cyclohexylbenzamide (PubChem CID 80658625) has the molecular formula C15H18BrCl2NO and a molecular weight of 379.13 g/mol. Its IUPAC name is N-(2-bromoethyl)-3,5-dichloro-N-cyclohexylbenzamide.
| Compound Name | N-(2-bromoethyl)-3,5-dichloro-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 80658625 |
| Molecular Formula | C15H18BrCl2NO |
| Molecular Weight | 379.13 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | N-(2-bromoethyl)-3,5-dichloro-N-cyclohexylbenzamide |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)N(CCBr)C1CCCCC1 |
| InChI | InChI=1S/C15H18BrCl2NO/c16-6-7-19(14-4-2-1-3-5-14)15(20)11-8-12(17)10-13(18)9-11/h8-10,14H,1-7H2 |
| InChIKey | LGFUSPMRYWCZMF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.13 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|