C14H16Cl3NO — CID 63391832
3,5-dichloro-N-(2-chloroethyl)-N-cyclopentylbenzamide (PubChem CID 63391832) has the molecular formula C14H16Cl3NO and a molecular weight of 320.65 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-chloroethyl)-N-cyclopentylbenzamide.
| Compound Name | 3,5-dichloro-N-(2-chloroethyl)-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 63391832 |
| Molecular Formula | C14H16Cl3NO |
| Molecular Weight | 320.65 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 3,5-dichloro-N-(2-chloroethyl)-N-cyclopentylbenzamide |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)N(CCCl)C1CCCC1 |
| InChI | InChI=1S/C14H16Cl3NO/c15-5-6-18(13-3-1-2-4-13)14(19)10-7-11(16)9-12(17)8-10/h7-9,13H,1-6H2 |
| InChIKey | PBBCREBDPJQONM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|