C12H10Cl2F2O2 — CID 118684300
ethyl 3,3-dichloro-2-(2,4-difluoro-5-methylphenyl)prop-2-enoate (PubChem CID 118684300) has the molecular formula C12H10Cl2F2O2 and a molecular weight of 295.11 g/mol. Its IUPAC name is ethyl 3,3-dichloro-2-(2,4-difluoro-5-methylphenyl)prop-2-enoate.
| Compound Name | ethyl 3,3-dichloro-2-(2,4-difluoro-5-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 118684300 |
| Molecular Formula | C12H10Cl2F2O2 |
| Molecular Weight | 295.11 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | ethyl 3,3-dichloro-2-(2,4-difluoro-5-methylphenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(=C(Cl)Cl)c1cc(C)c(F)cc1F |
| InChI | InChI=1S/C12H10Cl2F2O2/c1-3-18-12(17)10(11(13)14)7-4-6(2)8(15)5-9(7)16/h4-5H,3H2,1-2H3 |
| InChIKey | DOFKUHKXZDAAON-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.11 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|