C27H19BrCl5F3O5 — CID 158904024
1-bromo-4-chloro-2-fluorobenzene;ethyl 2-(4-chloro-2-fluorophenyl)-2-oxoacetate;ethyl 3,3-dichloro-2-(4-chloro-2-fluorophenyl)prop-2-enoate (PubChem CID 158904024) has the molecular formula C27H19BrCl5F3O5 and a molecular weight of 737.61 g/mol. Its IUPAC name is 1-bromo-4-chloro-2-fluorobenzene;ethyl 2-(4-chloro-2-fluorophenyl)-2-oxoacetate;ethyl 3,3-dichloro-2-(4-chloro-2-fluorophenyl)prop-2-enoate.
| Compound Name | 1-bromo-4-chloro-2-fluorobenzene;ethyl 2-(4-chloro-2-fluorophenyl)-2-oxoacetate;ethyl 3,3-dichloro-2-(4-chloro-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 158904024 |
| Molecular Formula | C27H19BrCl5F3O5 |
| Molecular Weight | 737.61 g/mol |
| Exact Mass | 733.88 |
| IUPAC Name | 1-bromo-4-chloro-2-fluorobenzene;ethyl 2-(4-chloro-2-fluorophenyl)-2-oxoacetate;ethyl 3,3-dichloro-2-(4-chloro-2-fluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(=C(Cl)Cl)c1ccc(Cl)cc1F.CCOC(=O)C(=O)c1ccc(Cl)cc1F.Fc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C11H8Cl3FO2.C10H8ClFO3.C6H3BrClF/c1-2-17-11(16)9(10(13)14)7-4-3-6(12)5-8(7)15;1-2-15-10(14)9(13)7-4-3-6(11)5-8(7)12;7-5-2-1-4(8)3-6(5)9/h3-5H,2H2,1H3;3-5H,2H2,1H3;1-3H |
| InChIKey | JFUSIPHZPXLYEZ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.61 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|