C11H12BrClFNO2 — CID 171247647
ethyl (3S)-3-amino-3-(2-bromo-5-chlorophenyl)-2-fluoropropanoate (PubChem CID 171247647) has the molecular formula C11H12BrClFNO2 and a molecular weight of 324.58 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2-bromo-5-chlorophenyl)-2-fluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(2-bromo-5-chlorophenyl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 171247647 |
| Molecular Formula | C11H12BrClFNO2 |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2-bromo-5-chlorophenyl)-2-fluoropropanoate |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C11H12BrClFNO2/c1-2-17-11(16)9(14)10(15)7-5-6(13)3-4-8(7)12/h3-5,9-10H,2,15H2,1H3/t9?,10-/m0/s1 |
| InChIKey | DWSIHIGDTATUOA-AXDSSHIGSA-N |
| XLogP | 3.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |