C11H13BrCl2FNO2 — CID 171247648
ethyl (3S)-3-amino-3-(2-bromo-5-chlorophenyl)-2-fluoropropanoate;hydrochloride (PubChem CID 171247648) has the molecular formula C11H13BrCl2FNO2 and a molecular weight of 361.04 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2-bromo-5-chlorophenyl)-2-fluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(2-bromo-5-chlorophenyl)-2-fluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171247648 |
| Molecular Formula | C11H13BrCl2FNO2 |
| Molecular Weight | 361.04 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2-bromo-5-chlorophenyl)-2-fluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1cc(Cl)ccc1Br.Cl |
| InChI | InChI=1S/C11H12BrClFNO2.ClH/c1-2-17-11(16)9(14)10(15)7-5-6(13)3-4-8(7)12;/h3-5,9-10H,2,15H2,1H3;1H/t9?,10-;/m0./s1 |
| InChIKey | SSUOLDVJZUZLTG-FTCYEJDNSA-N |
| XLogP | 3.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.04 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |