C12H12F2O2S2 — CID 102507259
O-ethyl [2-(2,4-difluoro-5-methylphenyl)-2-oxoethyl]sulfanylmethanethioate (PubChem CID 102507259) has the molecular formula C12H12F2O2S2 and a molecular weight of 290.36 g/mol. Its IUPAC name is O-ethyl [2-(2,4-difluoro-5-methylphenyl)-2-oxoethyl]sulfanylmethanethioate.
| Compound Name | O-ethyl [2-(2,4-difluoro-5-methylphenyl)-2-oxoethyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 102507259 |
| Molecular Formula | C12H12F2O2S2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | O-ethyl [2-(2,4-difluoro-5-methylphenyl)-2-oxoethyl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SCC(=O)c1cc(C)c(F)cc1F |
| InChI | InChI=1S/C12H12F2O2S2/c1-3-16-12(17)18-6-11(15)8-4-7(2)9(13)5-10(8)14/h4-5H,3,6H2,1-2H3 |
| InChIKey | OIIKHOACXAMBHI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|