C10H10F2O3S — CID 79731711
1-(2,4-difluoro-5-methylphenyl)-2-methylsulfonylethanone (PubChem CID 79731711) has the molecular formula C10H10F2O3S and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-methylphenyl)-2-methylsulfonylethanone.
| Compound Name | 1-(2,4-difluoro-5-methylphenyl)-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 79731711 |
| Molecular Formula | C10H10F2O3S |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 1-(2,4-difluoro-5-methylphenyl)-2-methylsulfonylethanone |
| SMILES | Cc1cc(C(=O)CS(C)(=O)=O)c(F)cc1F |
| InChI | InChI=1S/C10H10F2O3S/c1-6-3-7(9(12)4-8(6)11)10(13)5-16(2,14)15/h3-4H,5H2,1-2H3 |
| InChIKey | XJQIERPYWASBNK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |