C12H12F2O3 — CID 156848320
ethyl 3-(2,4-difluoro-5-methylphenyl)-3-oxopropanoate (PubChem CID 156848320) has the molecular formula C12H12F2O3 and a molecular weight of 242.22 g/mol. Its IUPAC name is ethyl 3-(2,4-difluoro-5-methylphenyl)-3-oxopropanoate.
| Compound Name | ethyl 3-(2,4-difluoro-5-methylphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 156848320 |
| Molecular Formula | C12H12F2O3 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | ethyl 3-(2,4-difluoro-5-methylphenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(C)c(F)cc1F |
| InChI | InChI=1S/C12H12F2O3/c1-3-17-12(16)6-11(15)8-4-7(2)9(13)5-10(8)14/h4-5H,3,6H2,1-2H3 |
| InChIKey | LLRXGDFQAKDQHG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|