About 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate
5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate (PubChem CID 158306451) has the molecular formula C20H17Br2ClF2O6
and a molecular weight of 586.61 g/mol. Its IUPAC name is 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate.
Molecular Properties
| Compound Name | 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate |
| PubChem CID | 158306451 |
| Molecular Formula | C20H17Br2ClF2O6 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 583.90 |
| IUPAC Name | 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(Br)c(OC)cc1F.COc1cc(F)c(C(=O)Cl)cc1Br |
| InChI | InChI=1S/C12H12BrFO4.C8H5BrClFO2/c1-3-18-12(16)6-10(15)7-4-8(13)11(17-2)5-9(7)14;1-13-7-3-6(11)4(8(10)12)2-5(7)9/h4-5H,3,6H2,1-2H3;2-3H,1H3 |
| InChIKey | GNDGAIIKRFNOCC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate?
The IUPAC name of 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate (CID 158306451) is 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate.
What is the SMILES notation for 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate?
The canonical SMILES for 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate is CCOC(=O)CC(=O)c1cc(Br)c(OC)cc1F.COc1cc(F)c(C(=O)Cl)cc1Br.
What is the InChIKey of 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate?
The InChIKey is GNDGAIIKRFNOCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrFO4.C8H5BrClFO2/c1-3-18-12(16)6-10(15)7-4-8(13)11(17-2)5-9(7)14;1-13-7-3-6(11)4(8(10)12)2-5(7)9/h4-5H,3,6H2,1-2H3;2-3H,1H3.
What are the key properties of 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate?
5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate has a molecular weight of 586.61 g/mol, XLogP of 5.71, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-fluoro-4-methoxybenzoyl chloride;ethyl 3-(5-bromo-2-fluoro-4-methoxyphenyl)-3-oxopropanoate is sourced from PubChem (CID 158306451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).