C9H9F2NO2 — CID 23394047
2,4-difluoro-N-methoxy-5-methylbenzamide (PubChem CID 23394047) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is 2,4-difluoro-N-methoxy-5-methylbenzamide.
| Compound Name | 2,4-difluoro-N-methoxy-5-methylbenzamide |
|---|---|
| PubChem CID | 23394047 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2,4-difluoro-N-methoxy-5-methylbenzamide |
| SMILES | CONC(=O)c1cc(C)c(F)cc1F |
| InChI | InChI=1S/C9H9F2NO2/c1-5-3-6(9(13)12-14-2)8(11)4-7(5)10/h3-4H,1-2H3,(H,12,13) |
| InChIKey | SVVIAZBLTJLOPF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|