C10H12FNO2 — CID 23394049
4-fluoro-N-methoxy-2,5-dimethylbenzamide (PubChem CID 23394049) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is 4-fluoro-N-methoxy-2,5-dimethylbenzamide.
| Compound Name | 4-fluoro-N-methoxy-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 23394049 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 4-fluoro-N-methoxy-2,5-dimethylbenzamide |
| SMILES | CONC(=O)c1cc(C)c(F)cc1C |
| InChI | InChI=1S/C10H12FNO2/c1-6-5-9(11)7(2)4-8(6)10(13)12-14-3/h4-5H,1-3H3,(H,12,13) |
| InChIKey | KLQGJPKIODEHEN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|