C15H15FIN3O3 — CID 59342492
2-(2-fluoro-4-iodoanilino)-N-methoxy-1,5-dimethyl-6-oxopyridine-3-carboxamide (PubChem CID 59342492) has the molecular formula C15H15FIN3O3 and a molecular weight of 431.21 g/mol. Its IUPAC name is 2-(2-fluoro-4-iodoanilino)-N-methoxy-1,5-dimethyl-6-oxopyridine-3-carboxamide.
| Compound Name | 2-(2-fluoro-4-iodoanilino)-N-methoxy-1,5-dimethyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 59342492 |
| Molecular Formula | C15H15FIN3O3 |
| Molecular Weight | 431.21 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 2-(2-fluoro-4-iodoanilino)-N-methoxy-1,5-dimethyl-6-oxopyridine-3-carboxamide |
| SMILES | CONC(=O)c1cc(C)c(=O)n(C)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C15H15FIN3O3/c1-8-6-10(14(21)19-23-3)13(20(2)15(8)22)18-12-5-4-9(17)7-11(12)16/h4-7,18H,1-3H3,(H,19,21) |
| InChIKey | TXPJMHBIZCFRFV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|