C16H17FIN3O4 — CID 142791554
N'-(2-fluoro-4-iodophenyl)-2-(2-hydroxyethoxy)-1,5-dimethyl-6-oxopyridine-3-carbohydrazide (PubChem CID 142791554) has the molecular formula C16H17FIN3O4 and a molecular weight of 461.23 g/mol. Its IUPAC name is N'-(2-fluoro-4-iodophenyl)-2-(2-hydroxyethoxy)-1,5-dimethyl-6-oxopyridine-3-carbohydrazide.
| Compound Name | N'-(2-fluoro-4-iodophenyl)-2-(2-hydroxyethoxy)-1,5-dimethyl-6-oxopyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 142791554 |
| Molecular Formula | C16H17FIN3O4 |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | N'-(2-fluoro-4-iodophenyl)-2-(2-hydroxyethoxy)-1,5-dimethyl-6-oxopyridine-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNc2ccc(I)cc2F)c(OCCO)n(C)c1=O |
| InChI | InChI=1S/C16H17FIN3O4/c1-9-7-11(16(25-6-5-22)21(2)15(9)24)14(23)20-19-13-4-3-10(18)8-12(13)17/h3-4,7-8,19,22H,5-6H2,1-2H3,(H,20,23) |
| InChIKey | ANGRMDATPPDQLW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|