C14H14FIN4O4 — CID 91604554
4-[(2-fluoro-4-iodoanilino)methoxy]-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide (PubChem CID 91604554) has the molecular formula C14H14FIN4O4 and a molecular weight of 448.19 g/mol. Its IUPAC name is 4-[(2-fluoro-4-iodoanilino)methoxy]-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide.
| Compound Name | 4-[(2-fluoro-4-iodoanilino)methoxy]-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91604554 |
| Molecular Formula | C14H14FIN4O4 |
| Molecular Weight | 448.19 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | 4-[(2-fluoro-4-iodoanilino)methoxy]-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide |
| SMILES | Cn1c(OCNc2ccc(I)cc2F)c(C(N)=O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H14FIN4O4/c1-19-12(22)10(11(17)21)13(20(2)14(19)23)24-6-18-9-4-3-7(16)5-8(9)15/h3-5,18H,6H2,1-2H3,(H2,17,21) |
| InChIKey | HRVNGNXXZBRCNS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|